| Name | diethyl ethylidenemalonate |
| Synonyms | DIETHYL ETHYLIDENEMALONATE diethyl ethylidenemalonate Diethyl 2-ethylidenemalonate diethyl ethylidenepropanedioate diethyl 2-ethylidenepropanedioate Diethyl 1-propene-1,1-dicarboxylate Ethylidenemalonic acid diethyl ester 2-ethylidenemalonic acid diethyl ester Diethyl 2-ethylidenepropane-1,3-dioate Propanedioic acid, ethylidene-, diethyl ester 1-Propene-1,1-dicarboxylic acid diethyl ester |
| CAS | 1462-12-0 |
| EINECS | 215-965-5 |
| InChI | InChI=1/C9H14O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h4H,5-6H2,1-3H3 |
| InChIKey | LBBAWVLUOZVYCC-UHFFFAOYSA-N |
| Molecular Formula | C9H14O4 |
| Molar Mass | 186.21 |
| Density | 1.019 g/mL at 25 °C (lit.) |
| Boling Point | 115-118 °C/17 mmHg (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.0601mmHg at 25°C |
| Specific Gravity | 1.019 |
| BRN | 1773932 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.442(lit.) |
| MDL | MFCD00009145 |
| Hazard Symbols | Xi - Irritant![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |